C12H15ClF3NO2S — CID 79267286
N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 79267286) has the molecular formula C12H15ClF3NO2S and a molecular weight of 329.77 g/mol. Its IUPAC name is N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 79267286 |
| Molecular Formula | C12H15ClF3NO2S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CC(C)C(CCl)Nc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15ClF3NO2S/c1-8(2)10(7-13)17-9-5-3-4-6-11(9)20(18,19)12(14,15)16/h3-6,8,10,17H,7H2,1-2H3 |
| InChIKey | OBMZCAJLSRUDCI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|