C12H16F3NO3S — CID 64558011
2-methyl-2-[2-(trifluoromethylsulfonyl)anilino]butan-1-ol (PubChem CID 64558011) has the molecular formula C12H16F3NO3S and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-methyl-2-[2-(trifluoromethylsulfonyl)anilino]butan-1-ol.
| Compound Name | 2-methyl-2-[2-(trifluoromethylsulfonyl)anilino]butan-1-ol |
|---|---|
| PubChem CID | 64558011 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-methyl-2-[2-(trifluoromethylsulfonyl)anilino]butan-1-ol |
| SMILES | CCC(C)(CO)Nc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3S/c1-3-11(2,8-17)16-9-6-4-5-7-10(9)20(18,19)12(13,14)15/h4-7,16-17H,3,8H2,1-2H3 |
| InChIKey | FPMLDDKHJWIGSE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |