C13H18F3NO2S — CID 63541038
N-hexan-2-yl-2-(trifluoromethylsulfonyl)aniline (PubChem CID 63541038) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-hexan-2-yl-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-hexan-2-yl-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 63541038 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-hexan-2-yl-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CCCCC(C)Nc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO2S/c1-3-4-7-10(2)17-11-8-5-6-9-12(11)20(18,19)13(14,15)16/h5-6,8-10,17H,3-4,7H2,1-2H3 |
| InChIKey | FDSSDBAHZCVYNW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |