C13H22N2O3S — CID 106171730
2-[(1-hydroxy-3-methylpentan-3-yl)amino]-N-methylbenzenesulfonamide (PubChem CID 106171730) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-methylpentan-3-yl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-[(1-hydroxy-3-methylpentan-3-yl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106171730 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-[(1-hydroxy-3-methylpentan-3-yl)amino]-N-methylbenzenesulfonamide |
| SMILES | CCC(C)(CCO)Nc1ccccc1S(=O)(=O)NC |
| InChI | InChI=1S/C13H22N2O3S/c1-4-13(2,9-10-16)15-11-7-5-6-8-12(11)19(17,18)14-3/h5-8,14-16H,4,9-10H2,1-3H3 |
| InChIKey | ZAQIEDMLELOFFD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |