C9H12N2O6S2 — CID 43696150
2-[[2-(methylsulfamoyl)phenyl]sulfamoyl]acetic acid (PubChem CID 43696150) has the molecular formula C9H12N2O6S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[[2-(methylsulfamoyl)phenyl]sulfamoyl]acetic acid.
| Compound Name | 2-[[2-(methylsulfamoyl)phenyl]sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43696150 |
| Molecular Formula | C9H12N2O6S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-[[2-(methylsulfamoyl)phenyl]sulfamoyl]acetic acid |
| SMILES | CNS(=O)(=O)c1ccccc1NS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C9H12N2O6S2/c1-10-19(16,17)8-5-3-2-4-7(8)11-18(14,15)6-9(12)13/h2-5,10-11H,6H2,1H3,(H,12,13) |
| InChIKey | DCUMGPRNQAYGQZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |