C12H17N3O5S — CID 64896402
4-amino-5-[2-(methylsulfamoyl)anilino]-5-oxopentanoic acid (PubChem CID 64896402) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-amino-5-[2-(methylsulfamoyl)anilino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[2-(methylsulfamoyl)anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64896402 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-amino-5-[2-(methylsulfamoyl)anilino]-5-oxopentanoic acid |
| SMILES | CNS(=O)(=O)c1ccccc1NC(=O)C(N)CCC(=O)O |
| InChI | InChI=1S/C12H17N3O5S/c1-14-21(19,20)10-5-3-2-4-9(10)15-12(18)8(13)6-7-11(16)17/h2-5,8,14H,6-7,13H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | DTDPHBZLEMPEBV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |