C13H21N3O3S — CID 107568567
(2S)-2-amino-N-[2-(ethylsulfamoyl)phenyl]pentanamide (PubChem CID 107568567) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(ethylsulfamoyl)phenyl]pentanamide.
| Compound Name | (2S)-2-amino-N-[2-(ethylsulfamoyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 107568567 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2S)-2-amino-N-[2-(ethylsulfamoyl)phenyl]pentanamide |
| SMILES | CCC[C@H](N)C(=O)Nc1ccccc1S(=O)(=O)NCC |
| InChI | InChI=1S/C13H21N3O3S/c1-3-7-10(14)13(17)16-11-8-5-6-9-12(11)20(18,19)15-4-2/h5-6,8-10,15H,3-4,7,14H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | GZMJXBKYIGPYAN-JTQLQIEISA-N |
| XLogP | 1.05 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |