C14H21N3O3S — CID 60853345
1-amino-N-[2-(ethylsulfamoyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 60853345) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-amino-N-[2-(ethylsulfamoyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-[2-(ethylsulfamoyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 60853345 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-amino-N-[2-(ethylsulfamoyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | CCNS(=O)(=O)c1ccccc1NC(=O)C1(N)CCCC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-16-21(19,20)12-8-4-3-7-11(12)17-13(18)14(15)9-5-6-10-14/h3-4,7-8,16H,2,5-6,9-10,15H2,1H3,(H,17,18) |
| InChIKey | PYRGCZMSMHUAFU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |