C13H22N2O2S — CID 62951903
2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide (PubChem CID 62951903) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide.
| Compound Name | 2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 62951903 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1NCCC(C)(C)C |
| InChI | InChI=1S/C13H22N2O2S/c1-13(2,3)9-10-15-11-7-5-6-8-12(11)18(16,17)14-4/h5-8,14-15H,9-10H2,1-4H3 |
| InChIKey | YKNHRHOSXNDHER-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |