C13H23N3O2S — CID 103287459
5-amino-2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide (PubChem CID 103287459) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 5-amino-2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103287459 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 5-amino-2-(3,3-dimethylbutylamino)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1NCCC(C)(C)C |
| InChI | InChI=1S/C13H23N3O2S/c1-13(2,3)7-8-16-11-6-5-10(14)9-12(11)19(17,18)15-4/h5-6,9,15-16H,7-8,14H2,1-4H3 |
| InChIKey | VWJQAKSTETVIDH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|