C15H27N3O2S — CID 103286934
5-amino-N-methyl-2-(2,4,4-trimethylpentan-2-ylamino)benzenesulfonamide (PubChem CID 103286934) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 5-amino-N-methyl-2-(2,4,4-trimethylpentan-2-ylamino)benzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-(2,4,4-trimethylpentan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 103286934 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 5-amino-N-methyl-2-(2,4,4-trimethylpentan-2-ylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H27N3O2S/c1-14(2,3)10-15(4,5)18-12-8-7-11(16)9-13(12)21(19,20)17-6/h7-9,17-18H,10,16H2,1-6H3 |
| InChIKey | GYONSYISJBOGIK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|