C12H18N6O2S — CID 103287111
5-amino-N-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzenesulfonamide (PubChem CID 103287111) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-amino-N-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 103287111 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-amino-N-methyl-2-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H18N6O2S/c1-14-21(19,20)11-7-9(13)4-5-10(11)15-6-2-3-12-16-8-17-18-12/h4-5,7-8,14-15H,2-3,6,13H2,1H3,(H,16,17,18) |
| InChIKey | KQQOTRIXVGKXLU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|