C11H12ClF3O4S2 — CID 66104704
1-(3-chloro-2-methylpropyl)sulfonyl-2-(trifluoromethylsulfonyl)benzene (PubChem CID 66104704) has the molecular formula C11H12ClF3O4S2 and a molecular weight of 364.79 g/mol. Its IUPAC name is 1-(3-chloro-2-methylpropyl)sulfonyl-2-(trifluoromethylsulfonyl)benzene.
| Compound Name | 1-(3-chloro-2-methylpropyl)sulfonyl-2-(trifluoromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 66104704 |
| Molecular Formula | C11H12ClF3O4S2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 1-(3-chloro-2-methylpropyl)sulfonyl-2-(trifluoromethylsulfonyl)benzene |
| SMILES | CC(CCl)CS(=O)(=O)c1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H12ClF3O4S2/c1-8(6-12)7-20(16,17)9-4-2-3-5-10(9)21(18,19)11(13,14)15/h2-5,8H,6-7H2,1H3 |
| InChIKey | ZCRHJZKDELOVOO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|