C13H18F3NO2S — CID 63202218
N,3-dimethyl-1-[2-(trifluoromethylsulfonyl)phenyl]butan-2-amine (PubChem CID 63202218) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is N,3-dimethyl-1-[2-(trifluoromethylsulfonyl)phenyl]butan-2-amine.
| Compound Name | N,3-dimethyl-1-[2-(trifluoromethylsulfonyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 63202218 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N,3-dimethyl-1-[2-(trifluoromethylsulfonyl)phenyl]butan-2-amine |
| SMILES | CNC(Cc1ccccc1S(=O)(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H18F3NO2S/c1-9(2)11(17-3)8-10-6-4-5-7-12(10)20(18,19)13(14,15)16/h4-7,9,11,17H,8H2,1-3H3 |
| InChIKey | IQVMXJASLQLKAN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |