C13H19F3N2O2S — CID 106155437
2-methyl-N'-[2-(trifluoromethylsulfonyl)phenyl]pentane-1,5-diamine (PubChem CID 106155437) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-methyl-N'-[2-(trifluoromethylsulfonyl)phenyl]pentane-1,5-diamine.
| Compound Name | 2-methyl-N'-[2-(trifluoromethylsulfonyl)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 106155437 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-methyl-N'-[2-(trifluoromethylsulfonyl)phenyl]pentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O2S/c1-10(9-17)5-4-8-18-11-6-2-3-7-12(11)21(19,20)13(14,15)16/h2-3,6-7,10,18H,4-5,8-9,17H2,1H3 |
| InChIKey | CMOLQFWIDPHYMN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|