C10H11F3N2O3S — CID 43553664
3-[2-(trifluoromethylsulfonyl)anilino]propanamide (PubChem CID 43553664) has the molecular formula C10H11F3N2O3S and a molecular weight of 296.27 g/mol. Its IUPAC name is 3-[2-(trifluoromethylsulfonyl)anilino]propanamide.
| Compound Name | 3-[2-(trifluoromethylsulfonyl)anilino]propanamide |
|---|---|
| PubChem CID | 43553664 |
| Molecular Formula | C10H11F3N2O3S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-[2-(trifluoromethylsulfonyl)anilino]propanamide |
| SMILES | NC(=O)CCNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3S/c11-10(12,13)19(17,18)8-4-2-1-3-7(8)15-6-5-9(14)16/h1-4,15H,5-6H2,(H2,14,16) |
| InChIKey | JRDDVSIFLAWCQL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |