C14H18F3NO4S — CID 60597269
methyl 6-[2-(trifluoromethylsulfonyl)anilino]hexanoate (PubChem CID 60597269) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is methyl 6-[2-(trifluoromethylsulfonyl)anilino]hexanoate.
| Compound Name | methyl 6-[2-(trifluoromethylsulfonyl)anilino]hexanoate |
|---|---|
| PubChem CID | 60597269 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl 6-[2-(trifluoromethylsulfonyl)anilino]hexanoate |
| SMILES | COC(=O)CCCCCNc1ccccc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO4S/c1-22-13(19)9-3-2-6-10-18-11-7-4-5-8-12(11)23(20,21)14(15,16)17/h4-5,7-8,18H,2-3,6,9-10H2,1H3 |
| InChIKey | UJGKCCFYNUTRSS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|