C13H17F4NO2S — CID 103462427
N-(2,2-dimethylbutyl)-4-fluoro-2-(trifluoromethylsulfonyl)aniline (PubChem CID 103462427) has the molecular formula C13H17F4NO2S and a molecular weight of 327.34 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-fluoro-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-(2,2-dimethylbutyl)-4-fluoro-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 103462427 |
| Molecular Formula | C13H17F4NO2S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-fluoro-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CCC(C)(C)CNc1ccc(F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H17F4NO2S/c1-4-12(2,3)8-18-10-6-5-9(14)7-11(10)21(19,20)13(15,16)17/h5-7,18H,4,8H2,1-3H3 |
| InChIKey | UZWUZBIITBNDIQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |