C11H13F4NO3S — CID 62891619
4-fluoro-N-(1-methoxypropan-2-yl)-2-(trifluoromethylsulfonyl)aniline (PubChem CID 62891619) has the molecular formula C11H13F4NO3S and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-fluoro-N-(1-methoxypropan-2-yl)-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-fluoro-N-(1-methoxypropan-2-yl)-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 62891619 |
| Molecular Formula | C11H13F4NO3S |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-fluoro-N-(1-methoxypropan-2-yl)-2-(trifluoromethylsulfonyl)aniline |
| SMILES | COCC(C)Nc1ccc(F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H13F4NO3S/c1-7(6-19-2)16-9-4-3-8(12)5-10(9)20(17,18)11(13,14)15/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | UDJGWWFNHXFPGS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |