C16H16F4N2O4S2 — CID 133283979
4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]-N-methylbenzenesulfonamide (PubChem CID 133283979) has the molecular formula C16H16F4N2O4S2 and a molecular weight of 440.44 g/mol. Its IUPAC name is 4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 133283979 |
| Molecular Formula | C16H16F4N2O4S2 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 4-[1-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C(C)Nc2ccc(F)cc2S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F4N2O4S2/c1-10(11-3-6-13(7-4-11)28(25,26)21-2)22-14-8-5-12(17)9-15(14)27(23,24)16(18,19)20/h3-10,21-22H,1-2H3 |
| InChIKey | NUGOTKBEINATHD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |