C9H9F4NO3S — CID 55129525
2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethanol (PubChem CID 55129525) has the molecular formula C9H9F4NO3S and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethanol.
| Compound Name | 2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethanol |
|---|---|
| PubChem CID | 55129525 |
| Molecular Formula | C9H9F4NO3S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethanol |
| SMILES | O=S(=O)(c1cc(F)ccc1NCCO)C(F)(F)F |
| InChI | InChI=1S/C9H9F4NO3S/c10-6-1-2-7(14-3-4-15)8(5-6)18(16,17)9(11,12)13/h1-2,5,14-15H,3-4H2 |
| InChIKey | BGIAUNZIYWAJAR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |