C14H12F4N2O3S2 — CID 133283504
N-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]thiophene-2-carboxamide (PubChem CID 133283504) has the molecular formula C14H12F4N2O3S2 and a molecular weight of 396.39 g/mol. Its IUPAC name is N-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 133283504 |
| Molecular Formula | C14H12F4N2O3S2 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-[2-[4-fluoro-2-(trifluoromethylsulfonyl)anilino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNc1ccc(F)cc1S(=O)(=O)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C14H12F4N2O3S2/c15-9-3-4-10(12(8-9)25(22,23)14(16,17)18)19-5-6-20-13(21)11-2-1-7-24-11/h1-4,7-8,19H,5-6H2,(H,20,21) |
| InChIKey | UPJURNPHKSZUDJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|