C13H12F3N3OS — CID 131963289
N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 131963289) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 131963289 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCNc1ncccc1C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C13H12F3N3OS/c14-13(15,16)9-3-1-5-17-11(9)18-6-7-19-12(20)10-4-2-8-21-10/h1-5,8H,6-7H2,(H,17,18)(H,19,20) |
| InChIKey | YDGHLXNKRRKYJC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|