C15H16F4N2O3S — CID 133347454
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline (PubChem CID 133347454) has the molecular formula C15H16F4N2O3S and a molecular weight of 380.36 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133347454 |
| Molecular Formula | C15H16F4N2O3S |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-4-fluoro-2-(trifluoromethylsulfonyl)aniline |
| SMILES | Cc1noc(C)c1CCCNc1ccc(F)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H16F4N2O3S/c1-9-12(10(2)24-21-9)4-3-7-20-13-6-5-11(16)8-14(13)25(22,23)15(17,18)19/h5-6,8,20H,3-4,7H2,1-2H3 |
| InChIKey | FCRMUZVWJQGVEM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|