C17H17ClFN3O — CID 133347573
4-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-8-fluoroquinolin-7-amine (PubChem CID 133347573) has the molecular formula C17H17ClFN3O and a molecular weight of 333.79 g/mol. Its IUPAC name is 4-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-8-fluoroquinolin-7-amine.
| Compound Name | 4-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-8-fluoroquinolin-7-amine |
|---|---|
| PubChem CID | 133347573 |
| Molecular Formula | C17H17ClFN3O |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-chloro-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-8-fluoroquinolin-7-amine |
| SMILES | Cc1noc(C)c1CCCNc1ccc2c(Cl)ccnc2c1F |
| InChI | InChI=1S/C17H17ClFN3O/c1-10-12(11(2)23-22-10)4-3-8-20-15-6-5-13-14(18)7-9-21-17(13)16(15)19/h5-7,9,20H,3-4,8H2,1-2H3 |
| InChIKey | JXAGWTDSCXDULP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|