C15H16F3NO4S — CID 133353165
2-(5-methylfuran-2-yl)-1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol (PubChem CID 133353165) has the molecular formula C15H16F3NO4S and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol.
| Compound Name | 2-(5-methylfuran-2-yl)-1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 133353165 |
| Molecular Formula | C15H16F3NO4S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-1-[2-(trifluoromethylsulfonyl)anilino]propan-2-ol |
| SMILES | Cc1ccc(C(C)(O)CNc2ccccc2S(=O)(=O)C(F)(F)F)o1 |
| InChI | InChI=1S/C15H16F3NO4S/c1-10-7-8-13(23-10)14(2,20)9-19-11-5-3-4-6-12(11)24(21,22)15(16,17)18/h3-8,19-20H,9H2,1-2H3 |
| InChIKey | PIHDGORRDJPMPI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |