C15H17F3N2O4S — CID 133353067
4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 133353067) has the molecular formula C15H17F3N2O4S and a molecular weight of 378.37 g/mol. Its IUPAC name is 4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133353067 |
| Molecular Formula | C15H17F3N2O4S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-[[2-hydroxy-2-(5-methylfuran-2-yl)propyl]amino]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C(C)(O)CNc2ccc(S(N)(=O)=O)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C15H17F3N2O4S/c1-9-3-6-13(24-9)14(2,21)8-20-12-5-4-10(25(19,22)23)7-11(12)15(16,17)18/h3-7,20-21H,8H2,1-2H3,(H2,19,22,23) |
| InChIKey | JMKOANPULISHFT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |