C14H13Cl2F3N4O2S — CID 133316807
4-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 133316807) has the molecular formula C14H13Cl2F3N4O2S and a molecular weight of 429.25 g/mol. Its IUPAC name is 4-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133316807 |
| Molecular Formula | C14H13Cl2F3N4O2S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 4-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCNc2ncc(Cl)cc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13Cl2F3N4O2S/c15-8-5-11(16)13(23-7-8)22-4-3-21-12-2-1-9(26(20,24)25)6-10(12)14(17,18)19/h1-2,5-7,21H,3-4H2,(H,22,23)(H2,20,24,25) |
| InChIKey | KFZLUOUWFJKJBD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|