C8H11Cl2N3 — CID 14397361
N'-(3,5-dichloro-2-pyridinyl)propane-1,3-diamine (PubChem CID 14397361) has the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. Its IUPAC name is N'-(3,5-dichloro-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N'-(3,5-dichloro-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 14397361 |
| Molecular Formula | C8H11Cl2N3 |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | N'-(3,5-dichloro-2-pyridinyl)propane-1,3-diamine |
| SMILES | NCCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C8H11Cl2N3/c9-6-4-7(10)8(13-5-6)12-3-1-2-11/h4-5H,1-3,11H2,(H,12,13) |
| InChIKey | FUDDLIZJYWXWGO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|