C18H17F3N4O3S — CID 133291403
4-[[1-(4-methoxyphenyl)pyrazol-3-yl]methylamino]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 133291403) has the molecular formula C18H17F3N4O3S and a molecular weight of 426.42 g/mol. Its IUPAC name is 4-[[1-(4-methoxyphenyl)pyrazol-3-yl]methylamino]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[[1-(4-methoxyphenyl)pyrazol-3-yl]methylamino]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133291403 |
| Molecular Formula | C18H17F3N4O3S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 4-[[1-(4-methoxyphenyl)pyrazol-3-yl]methylamino]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(-n2ccc(CNc3ccc(S(N)(=O)=O)cc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H17F3N4O3S/c1-28-14-4-2-13(3-5-14)25-9-8-12(24-25)11-23-17-7-6-15(29(22,26)27)10-16(17)18(19,20)21/h2-10,23H,11H2,1H3,(H2,22,26,27) |
| InChIKey | HGMJFWVJNHUJNE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |