C7H7F3N2O4S2 — CID 154218249
4-(trifluoromethyl)benzene-1,3-disulfonamide (PubChem CID 154218249) has the molecular formula C7H7F3N2O4S2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-(trifluoromethyl)benzene-1,3-disulfonamide.
| Compound Name | 4-(trifluoromethyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 154218249 |
| Molecular Formula | C7H7F3N2O4S2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 4-(trifluoromethyl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(F)(F)F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H7F3N2O4S2/c8-7(9,10)5-2-1-4(17(11,13)14)3-6(5)18(12,15)16/h1-3H,(H2,11,13,14)(H2,12,15,16) |
| InChIKey | HQGTYYWTFKADMV-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |