C9H5F6NO3S — CID 134638617
4-formyl-2,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 134638617) has the molecular formula C9H5F6NO3S and a molecular weight of 321.20 g/mol. Its IUPAC name is 4-formyl-2,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-formyl-2,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134638617 |
| Molecular Formula | C9H5F6NO3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 4-formyl-2,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(F)(F)F)c(C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO3S/c10-8(11,12)5-2-7(20(16,18)19)6(9(13,14)15)1-4(5)3-17/h1-3H,(H2,16,18,19) |
| InChIKey | QZOOXPFUHQPAQY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|