C7H7F3N2O5S2 — CID 174929186
4-amino-5-sulfamoyl-2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 174929186) has the molecular formula C7H7F3N2O5S2 and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-amino-5-sulfamoyl-2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 4-amino-5-sulfamoyl-2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 174929186 |
| Molecular Formula | C7H7F3N2O5S2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 4-amino-5-sulfamoyl-2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Nc1cc(C(F)(F)F)c(S(=O)(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H7F3N2O5S2/c8-7(9,10)3-1-4(11)6(18(12,13)14)2-5(3)19(15,16)17/h1-2H,11H2,(H2,12,13,14)(H,15,16,17) |
| InChIKey | XQNZUARTJFOFBI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|