C10H9F6NO2S — CID 119003631
4-ethyl-2,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 119003631) has the molecular formula C10H9F6NO2S and a molecular weight of 321.24 g/mol. Its IUPAC name is 4-ethyl-2,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-ethyl-2,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119003631 |
| Molecular Formula | C10H9F6NO2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-ethyl-2,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | CCc1cc(C(F)(F)F)c(S(N)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO2S/c1-2-5-3-7(10(14,15)16)8(20(17,18)19)4-6(5)9(11,12)13/h3-4H,2H2,1H3,(H2,17,18,19) |
| InChIKey | TVMHPICPCGFLOK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |