C10H9F3N2O5S — CID 154136746
2-acetamido-5-sulfamoyl-4-(trifluoromethyl)benzoic acid (PubChem CID 154136746) has the molecular formula C10H9F3N2O5S and a molecular weight of 326.25 g/mol. Its IUPAC name is 2-acetamido-5-sulfamoyl-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-acetamido-5-sulfamoyl-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 154136746 |
| Molecular Formula | C10H9F3N2O5S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-acetamido-5-sulfamoyl-4-(trifluoromethyl)benzoic acid |
| SMILES | CC(=O)Nc1cc(C(F)(F)F)c(S(N)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C10H9F3N2O5S/c1-4(16)15-7-3-6(10(11,12)13)8(21(14,19)20)2-5(7)9(17)18/h2-3H,1H3,(H,15,16)(H,17,18)(H2,14,19,20) |
| InChIKey | AKSYSCYGXXOWNY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |