C10H11F3N2O4S — CID 122049439
(2S)-2-[4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid (PubChem CID 122049439) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is (2S)-2-[4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | (2S)-2-[4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 122049439 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (2S)-2-[4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid |
| SMILES | C[C@H](Nc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C10H11F3N2O4S/c1-5(9(16)17)15-6-2-3-8(20(14,18)19)7(4-6)10(11,12)13/h2-5,15H,1H3,(H,16,17)(H2,14,18,19)/t5-/m0/s1 |
| InChIKey | LSORXMMFIMOWAB-YFKPBYRVSA-N |
| XLogP | 1.24 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |