About 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide
4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133340002) has the molecular formula C16H15F5N2O2S
and a molecular weight of 394.37 g/mol. Its IUPAC name is 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 133340002 |
| Molecular Formula | C16H15F5N2O2S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC(Nc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F5N2O2S/c1-2-14(11-5-3-9(17)7-13(11)18)23-10-4-6-15(26(22,24)25)12(8-10)16(19,20)21/h3-8,14,23H,2H2,1H3,(H2,22,24,25) |
| InChIKey | FJCAWUMBUWCSST-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide (CID 133340002) is 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide is CCC(Nc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1)c1ccc(F)cc1F.
What is the InChIKey of 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is FJCAWUMBUWCSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F5N2O2S/c1-2-14(11-5-3-9(17)7-13(11)18)23-10-4-6-15(26(22,24)25)12(8-10)16(19,20)21/h3-8,14,23H,2H2,1H3,(H2,22,24,25).
What are the key properties of 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide?
4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 394.37 g/mol, XLogP of 4.19, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,4-difluorophenyl)propylamino]-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 133340002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).