C15H17F3N2O2S2 — CID 133340008
4-[1-(5-methylthiophen-2-yl)propan-2-ylamino]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133340008) has the molecular formula C15H17F3N2O2S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-[1-(5-methylthiophen-2-yl)propan-2-ylamino]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-[1-(5-methylthiophen-2-yl)propan-2-ylamino]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133340008 |
| Molecular Formula | C15H17F3N2O2S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 4-[1-(5-methylthiophen-2-yl)propan-2-ylamino]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(CC(C)Nc2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H17F3N2O2S2/c1-9(7-12-5-3-10(2)23-12)20-11-4-6-14(24(19,21)22)13(8-11)15(16,17)18/h3-6,8-9,20H,7H2,1-2H3,(H2,19,21,22) |
| InChIKey | WRJPSFXTORITII-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |