C15H23F3N2O2S — CID 133339931
4-(5,5-dimethylhexan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133339931) has the molecular formula C15H23F3N2O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-(5,5-dimethylhexan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-(5,5-dimethylhexan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133339931 |
| Molecular Formula | C15H23F3N2O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-(5,5-dimethylhexan-2-ylamino)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(CCC(C)(C)C)Nc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H23F3N2O2S/c1-10(7-8-14(2,3)4)20-11-5-6-13(23(19,21)22)12(9-11)15(16,17)18/h5-6,9-10,20H,7-8H2,1-4H3,(H2,19,21,22) |
| InChIKey | ADXOOCYIODOSEG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |