C13H9F5N2O2S — CID 70908235
4-(2,4-difluoroanilino)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 70908235) has the molecular formula C13H9F5N2O2S and a molecular weight of 352.28 g/mol. Its IUPAC name is 4-(2,4-difluoroanilino)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-(2,4-difluoroanilino)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70908235 |
| Molecular Formula | C13H9F5N2O2S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-(2,4-difluoroanilino)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ccc(F)cc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H9F5N2O2S/c14-7-1-3-11(10(15)5-7)20-8-2-4-12(23(19,21)22)9(6-8)13(16,17)18/h1-6,20H,(H2,19,21,22) |
| InChIKey | OEGHYZFNOAFIQJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |