C12H9ClF3N3O2S — CID 45035603
4-[4-chloro-3-(trifluoromethyl)anilino]pyridine-3-sulfonamide (PubChem CID 45035603) has the molecular formula C12H9ClF3N3O2S and a molecular weight of 351.74 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)anilino]pyridine-3-sulfonamide.
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)anilino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 45035603 |
| Molecular Formula | C12H9ClF3N3O2S |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)anilino]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cnccc1Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9ClF3N3O2S/c13-9-2-1-7(5-8(9)12(14,15)16)19-10-3-4-18-6-11(10)22(17,20)21/h1-6H,(H,18,19)(H2,17,20,21) |
| InChIKey | NSUPOFXSQFVKNZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |