C22H14ClF3N4O — CID 11640796
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide (PubChem CID 11640796) has the molecular formula C22H14ClF3N4O and a molecular weight of 442.83 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11640796 |
| Molecular Formula | C22H14ClF3N4O |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(isoquinolin-7-ylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cccnc1Nc1ccc2ccncc2c1 |
| InChI | InChI=1S/C22H14ClF3N4O/c23-19-6-5-16(11-18(19)22(24,25)26)30-21(31)17-2-1-8-28-20(17)29-15-4-3-13-7-9-27-12-14(13)10-15/h1-12H,(H,28,29)(H,30,31) |
| InChIKey | OVEQFNZUXGSCFP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |