C15H17ClN4O4S — CID 172970649
1-[[4-(3-chloro-4-hydroxyanilino)-3-pyridinyl]sulfonyl]-3-propan-2-ylurea (PubChem CID 172970649) has the molecular formula C15H17ClN4O4S and a molecular weight of 384.85 g/mol. Its IUPAC name is 1-[[4-(3-chloro-4-hydroxyanilino)-3-pyridinyl]sulfonyl]-3-propan-2-ylurea.
| Compound Name | 1-[[4-(3-chloro-4-hydroxyanilino)-3-pyridinyl]sulfonyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 172970649 |
| Molecular Formula | C15H17ClN4O4S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-[[4-(3-chloro-4-hydroxyanilino)-3-pyridinyl]sulfonyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NS(=O)(=O)c1cnccc1Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClN4O4S/c1-9(2)18-15(22)20-25(23,24)14-8-17-6-5-12(14)19-10-3-4-13(21)11(16)7-10/h3-9,21H,1-2H3,(H,17,19)(H2,18,20,22) |
| InChIKey | FOVANOQJFYZGMI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|