C18H25ClN4O4S — CID 172970621
1-[1-(methoxymethyl)-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-3-propan-2-ylurea chloride (PubChem CID 172970621) has the molecular formula C18H25ClN4O4S and a molecular weight of 428.94 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-3-propan-2-ylurea chloride.
| Compound Name | 1-[1-(methoxymethyl)-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-3-propan-2-ylurea chloride |
|---|---|
| PubChem CID | 172970621 |
| Molecular Formula | C18H25ClN4O4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-[1-(methoxymethyl)-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonyl-3-propan-2-ylurea chloride |
| SMILES | COC[n+]1ccc(Nc2cccc(C)c2)c(S(=O)(=O)NC(=O)NC(C)C)c1.[Cl-] |
| InChI | InChI=1S/C18H24N4O4S.ClH/c1-13(2)19-18(23)21-27(24,25)17-11-22(12-26-4)9-8-16(17)20-15-7-5-6-14(3)10-15;/h5-11,13H,12H2,1-4H3,(H2,19,21,23);1H |
| InChIKey | XERDSCKKVTWEBR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|