C18H25N4O3S+ — CID 91110800
1-[[1-methyl-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonylmethyl]-3-propan-2-ylurea (PubChem CID 91110800) has the molecular formula C18H25N4O3S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[[1-methyl-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonylmethyl]-3-propan-2-ylurea.
| Compound Name | 1-[[1-methyl-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonylmethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 91110800 |
| Molecular Formula | C18H25N4O3S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[[1-methyl-4-(3-methylanilino)pyridin-1-ium-3-yl]sulfonylmethyl]-3-propan-2-ylurea |
| SMILES | Cc1cccc(Nc2cc[n+](C)cc2S(=O)(=O)CNC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C18H24N4O3S/c1-13(2)20-18(23)19-12-26(24,25)17-11-22(4)9-8-16(17)21-15-7-5-6-14(3)10-15/h5-11,13H,12H2,1-4H3,(H2,19,20,23)/p+1 |
| InChIKey | TXPVPRGGVDIQSM-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|