C16H18CaN4O3S — CID 74821404
calcium [4-(3-methylanilino)-3-pyridinyl]sulfonyl-propan-2-ylazanidylcarbonylazanide (PubChem CID 74821404) has the molecular formula C16H18CaN4O3S and a molecular weight of 386.49 g/mol. Its IUPAC name is calcium [4-(3-methylanilino)-3-pyridinyl]sulfonyl-propan-2-ylazanidylcarbonylazanide.
| Compound Name | calcium [4-(3-methylanilino)-3-pyridinyl]sulfonyl-propan-2-ylazanidylcarbonylazanide |
|---|---|
| PubChem CID | 74821404 |
| Molecular Formula | C16H18CaN4O3S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | calcium [4-(3-methylanilino)-3-pyridinyl]sulfonyl-propan-2-ylazanidylcarbonylazanide |
| SMILES | Cc1cccc(Nc2ccncc2S(=O)(=O)[N-]C(=O)[N-]C(C)C)c1.[Ca+2] |
| InChI | InChI=1S/C16H19N4O3S.Ca/c1-11(2)18-16(21)20-24(22,23)15-10-17-8-7-14(15)19-13-6-4-5-12(3)9-13;/h4-11H,1-3H3,(H2-,17,18,19,20,21);/q-1;+2/p-1 |
| InChIKey | KGJAVHAHYMUZSY-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |