C15H14F3N3O4S — CID 1214468
ethyl N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]carbamate (PubChem CID 1214468) has the molecular formula C15H14F3N3O4S and a molecular weight of 389.36 g/mol. Its IUPAC name is ethyl N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]carbamate.
| Compound Name | ethyl N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]carbamate |
|---|---|
| PubChem CID | 1214468 |
| Molecular Formula | C15H14F3N3O4S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | ethyl N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)c1cnccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F3N3O4S/c1-2-25-14(22)21-26(23,24)13-9-19-7-6-12(13)20-11-5-3-4-10(8-11)15(16,17)18/h3-9H,2H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | INZIXSXWHAVVFS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |