C19H14F3N3O3S — CID 3043795
N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]benzamide (PubChem CID 3043795) has the molecular formula C19H14F3N3O3S and a molecular weight of 421.40 g/mol. Its IUPAC name is N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]benzamide.
| Compound Name | N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 3043795 |
| Molecular Formula | C19H14F3N3O3S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]benzamide |
| SMILES | O=C(NS(=O)(=O)c1cnccc1Nc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H14F3N3O3S/c20-19(21,22)14-7-4-8-15(11-14)24-16-9-10-23-12-17(16)29(27,28)25-18(26)13-5-2-1-3-6-13/h1-12H,(H,23,24)(H,25,26) |
| InChIKey | YDNVBYOTNMPYHX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |