C22H33N4O8PS — CID 166935680
[4-methoxyheptan-2-ylcarbamoyl-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]amino]methyl dihydrogen phosphate (PubChem CID 166935680) has the molecular formula C22H33N4O8PS and a molecular weight of 544.57 g/mol. Its IUPAC name is [4-methoxyheptan-2-ylcarbamoyl-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]amino]methyl dihydrogen phosphate.
| Compound Name | [4-methoxyheptan-2-ylcarbamoyl-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]amino]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 166935680 |
| Molecular Formula | C22H33N4O8PS |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | [4-methoxyheptan-2-ylcarbamoyl-[[4-(3-methylanilino)-3-pyridinyl]sulfonyl]amino]methyl dihydrogen phosphate |
| SMILES | CCCC(CC(C)NC(=O)N(COP(=O)(O)O)S(=O)(=O)c1cnccc1Nc1cccc(C)c1)OC |
| InChI | InChI=1S/C22H33N4O8PS/c1-5-7-19(33-4)13-17(3)24-22(27)26(15-34-35(28,29)30)36(31,32)21-14-23-11-10-20(21)25-18-9-6-8-16(2)12-18/h6,8-12,14,17,19H,5,7,13,15H2,1-4H3,(H,23,25)(H,24,27)(H2,28,29,30) |
| InChIKey | ATPPPDKHZDVSMY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|