C13H23N3O3S — CID 64605132
N-(4-methoxybutan-2-yl)-4-(propylamino)pyridine-3-sulfonamide (PubChem CID 64605132) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(4-methoxybutan-2-yl)-4-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-(4-methoxybutan-2-yl)-4-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64605132 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-(4-methoxybutan-2-yl)-4-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ccncc1S(=O)(=O)NC(C)CCOC |
| InChI | InChI=1S/C13H23N3O3S/c1-4-7-15-12-5-8-14-10-13(12)20(17,18)16-11(2)6-9-19-3/h5,8,10-11,16H,4,6-7,9H2,1-3H3,(H,14,15) |
| InChIKey | GCZNFELUGSNWOO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |